Organometallic Compounds
Filtered Search Results
4-(Trimethylsilyl)phenylboronic Acid (contains varying amounts of Anhydride), TCI America™
CAS: 17865-11-1 Molecular Formula: C9H15BO2Si Molecular Weight (g/mol): 194.11 MDL Number: MFCD00093348 InChI Key: NRPZMSUGPMYBCQ-UHFFFAOYSA-N Synonym: 4-(Trimethylsilyl)benzeneboronic Acid PubChem CID: 1710 IUPAC Name: [4-(trimethylsilyl)phenyl]boronic acid SMILES: C[Si](C)(C)C1=CC=C(C=C1)B(O)O
| PubChem CID | 1710 |
|---|---|
| CAS | 17865-11-1 |
| Molecular Weight (g/mol) | 194.11 |
| MDL Number | MFCD00093348 |
| SMILES | C[Si](C)(C)C1=CC=C(C=C1)B(O)O |
| Synonym | 4-(Trimethylsilyl)benzeneboronic Acid |
| IUPAC Name | [4-(trimethylsilyl)phenyl]boronic acid |
| InChI Key | NRPZMSUGPMYBCQ-UHFFFAOYSA-N |
| Molecular Formula | C9H15BO2Si |
Trimethylsilyl Isocyanate 95.0+%, TCI America™
CAS: 1118-02-1 Molecular Formula: C4H9NOSi Molecular Weight (g/mol): 115.21 MDL Number: MFCD00001993 InChI Key: NIZHERJWXFHGGU-UHFFFAOYSA-N Synonym: trimethylsilyl isocyanate,silane, isocyanatotrimethyl,trimethylsilylisocyanate,isocyanato trimethyl silane,trimethylisocyanatosilane,tmsisocyanate,tms isocyanate,tms-isocyanate,tms isocynate PubChem CID: 70696 IUPAC Name: isocyanatotrimethylsilane SMILES: C[Si](C)(C)N=C=O
| PubChem CID | 70696 |
|---|---|
| CAS | 1118-02-1 |
| Molecular Weight (g/mol) | 115.21 |
| MDL Number | MFCD00001993 |
| SMILES | C[Si](C)(C)N=C=O |
| Synonym | trimethylsilyl isocyanate,silane, isocyanatotrimethyl,trimethylsilylisocyanate,isocyanato trimethyl silane,trimethylisocyanatosilane,tmsisocyanate,tms isocyanate,tms-isocyanate,tms isocynate |
| IUPAC Name | isocyanatotrimethylsilane |
| InChI Key | NIZHERJWXFHGGU-UHFFFAOYSA-N |
| Molecular Formula | C4H9NOSi |
1,1,3,3,5,5-Hexaethoxy-1,3,5-trisilacyclohexane 90.0+%, TCI America™
CAS: 17955-67-8 Molecular Formula: C15H36O6Si3 Molecular Weight (g/mol): 396.70 MDL Number: MFCD06660097 InChI Key: SPEDTQCGQOZHQP-UHFFFAOYSA-N Synonym: 1,1,3,3,5,5-Hexaethoxy-1,3,5-trisilinane PubChem CID: 10960278 IUPAC Name: 1,1,3,3,5,5-hexaethoxy-1,3,5-trisilinane SMILES: CCO[Si]1(C[Si](C[Si](C1)(OCC)OCC)(OCC)OCC)OCC
| PubChem CID | 10960278 |
|---|---|
| CAS | 17955-67-8 |
| Molecular Weight (g/mol) | 396.70 |
| MDL Number | MFCD06660097 |
| SMILES | CCO[Si]1(C[Si](C[Si](C1)(OCC)OCC)(OCC)OCC)OCC |
| Synonym | 1,1,3,3,5,5-Hexaethoxy-1,3,5-trisilinane |
| IUPAC Name | 1,1,3,3,5,5-hexaethoxy-1,3,5-trisilinane |
| InChI Key | SPEDTQCGQOZHQP-UHFFFAOYSA-N |
| Molecular Formula | C15H36O6Si3 |
Trimethoxy(p-tolyl)silane 97.0+%, TCI America™
CAS: 17873-01-7 Molecular Formula: C10H16O3Si Molecular Weight (g/mol): 212.32 MDL Number: MFCD00048020 InChI Key: XQEGZYAXBCFSBS-UHFFFAOYSA-N PubChem CID: 2760672 IUPAC Name: trimethoxy-(4-methylphenyl)silane SMILES: CC1=CC=C(C=C1)[Si](OC)(OC)OC
| PubChem CID | 2760672 |
|---|---|
| CAS | 17873-01-7 |
| Molecular Weight (g/mol) | 212.32 |
| MDL Number | MFCD00048020 |
| SMILES | CC1=CC=C(C=C1)[Si](OC)(OC)OC |
| IUPAC Name | trimethoxy-(4-methylphenyl)silane |
| InChI Key | XQEGZYAXBCFSBS-UHFFFAOYSA-N |
| Molecular Formula | C10H16O3Si |
Chlorodimethylphenylsilane 96.0+%, TCI America™
CAS: 768-33-2 Molecular Formula: C8H11ClSi Molecular Weight (g/mol): 170.71 MDL Number: MFCD00000499 InChI Key: KWYZNESIGBQHJK-UHFFFAOYSA-N Synonym: chlorodimethylphenylsilane,chlorodimethyl phenyl silane,phenyldimethylchlorosilane,silane, chlorodimethylphenyl,dimethylphenylchlorosilane,chloro dimethyl phenylsilane,phenyl dimethylchlorosilane,chloro-dimethyl-phenyl-silane,benzene, chlorodimethylsilyl,pubchem10814 PubChem CID: 13029 IUPAC Name: chlorodimethylphenylsilane SMILES: C[Si](C)(Cl)C1=CC=CC=C1
| PubChem CID | 13029 |
|---|---|
| CAS | 768-33-2 |
| Molecular Weight (g/mol) | 170.71 |
| MDL Number | MFCD00000499 |
| SMILES | C[Si](C)(Cl)C1=CC=CC=C1 |
| Synonym | chlorodimethylphenylsilane,chlorodimethyl phenyl silane,phenyldimethylchlorosilane,silane, chlorodimethylphenyl,dimethylphenylchlorosilane,chloro dimethyl phenylsilane,phenyl dimethylchlorosilane,chloro-dimethyl-phenyl-silane,benzene, chlorodimethylsilyl,pubchem10814 |
| IUPAC Name | chlorodimethylphenylsilane |
| InChI Key | KWYZNESIGBQHJK-UHFFFAOYSA-N |
| Molecular Formula | C8H11ClSi |
Triphenylbismuth Difluoride 97.0+%, TCI America™
CAS: 2023-48-5 Molecular Formula: C18H15BiF2 Molecular Weight (g/mol): 478.295 InChI Key: OSGJIYNQSIPLAQ-UHFFFAOYSA-L Synonym: Difluorotriphenylbismuth PubChem CID: 4573913 IUPAC Name: difluoro(triphenyl)bismuth SMILES: C1=CC=C(C=C1)[Bi](C2=CC=CC=C2)(C3=CC=CC=C3)(F)F
| PubChem CID | 4573913 |
|---|---|
| CAS | 2023-48-5 |
| Molecular Weight (g/mol) | 478.295 |
| SMILES | C1=CC=C(C=C1)[Bi](C2=CC=CC=C2)(C3=CC=CC=C3)(F)F |
| Synonym | Difluorotriphenylbismuth |
| IUPAC Name | difluoro(triphenyl)bismuth |
| InChI Key | OSGJIYNQSIPLAQ-UHFFFAOYSA-L |
| Molecular Formula | C18H15BiF2 |
(Piperidinium-1-ylmethyl)trifluoroborate 96.0+%, TCI America™
CAS: 1268340-93-7 Molecular Formula: C6H13BF3N Molecular Weight (g/mol): 166.982 MDL Number: MFCD18071160 InChI Key: PFMNVTAJBBIDDU-UHFFFAOYSA-O Synonym: piperidinium-1-ylmethyl trifluoroborate,piperidinium-1-ylmethyltrifluoroboronanion,trifluoro piperidin-1-ium-1-ylmethyl boranuide,trifluoro piperidin-1-ium-1-yl methyl borate 1-,piperidinium-1-ylmethyl trifluoroborate, internal salt PubChem CID: 53243642 IUPAC Name: trifluoro(piperidin-1-ium-1-ylmethyl)boranuide SMILES: [B-](C[NH+]1CCCCC1)(F)(F)F
| PubChem CID | 53243642 |
|---|---|
| CAS | 1268340-93-7 |
| Molecular Weight (g/mol) | 166.982 |
| MDL Number | MFCD18071160 |
| SMILES | [B-](C[NH+]1CCCCC1)(F)(F)F |
| Synonym | piperidinium-1-ylmethyl trifluoroborate,piperidinium-1-ylmethyltrifluoroboronanion,trifluoro piperidin-1-ium-1-ylmethyl boranuide,trifluoro piperidin-1-ium-1-yl methyl borate 1-,piperidinium-1-ylmethyl trifluoroborate, internal salt |
| IUPAC Name | trifluoro(piperidin-1-ium-1-ylmethyl)boranuide |
| InChI Key | PFMNVTAJBBIDDU-UHFFFAOYSA-O |
| Molecular Formula | C6H13BF3N |
Tetrakis(trimethylsilyl)silane 98.0+%, TCI America™
CAS: 4098-98-0 Molecular Formula: C12H36Si5 Molecular Weight (g/mol): 320.85 MDL Number: MFCD00054859 InChI Key: BOJSDHZZKKYWAS-UHFFFAOYSA-N Synonym: tetrakis trimethylsilyl silane,1,1,1,3,3,3-hexamethyl-2,2-bis trimethylsilyl trisilane,tetrakil trimethylsilyl silane,si si ch3 3 4,trisilane, 1,1,1,3,3,3-hexamethyl-2,2-bis trimethylsilyl,2,2-bis trimethylsilyl-1,1,1,3,3,3-hexamethyl-trisilane,acmc-1an6g,tetra trimethylsilyl-silane,bojsdhzzkkywas-uhfffaoysa PubChem CID: 138115 IUPAC Name: 1,1,1,3,3,3-hexamethyl-2,2-bis(trimethylsilyl)trisilane SMILES: C[Si](C)(C)[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C
| PubChem CID | 138115 |
|---|---|
| CAS | 4098-98-0 |
| Molecular Weight (g/mol) | 320.85 |
| MDL Number | MFCD00054859 |
| SMILES | C[Si](C)(C)[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
| Synonym | tetrakis trimethylsilyl silane,1,1,1,3,3,3-hexamethyl-2,2-bis trimethylsilyl trisilane,tetrakil trimethylsilyl silane,si si ch3 3 4,trisilane, 1,1,1,3,3,3-hexamethyl-2,2-bis trimethylsilyl,2,2-bis trimethylsilyl-1,1,1,3,3,3-hexamethyl-trisilane,acmc-1an6g,tetra trimethylsilyl-silane,bojsdhzzkkywas-uhfffaoysa |
| IUPAC Name | 1,1,1,3,3,3-hexamethyl-2,2-bis(trimethylsilyl)trisilane |
| InChI Key | BOJSDHZZKKYWAS-UHFFFAOYSA-N |
| Molecular Formula | C12H36Si5 |
1,1,1,5,5,5-Hexamethyl-3-[(trimethylsilyl)oxy]-3-vinyltrisiloxane 98.0+%, TCI America™
CAS: 5356-84-3 Molecular Formula: C11H30O3Si4 Molecular Weight (g/mol): 322.70 MDL Number: MFCD00054159 InChI Key: CHEFFAKKAFRMHG-UHFFFAOYSA-N Synonym: vinyl tris trimethylsiloxy silane,vinyltris trimethylsiloxy silane,1,1,1,5,5,5-hexamethyl-3-trimethylsilyl oxy-3-vinyltrisiloxane,tris trimethylsiloxy vinyl silane,trisiloxane, 3-ethenyl-1,1,1,5,5,5-hexamethyl-3-trimethylsilyl oxy,4-ethenyl-2,2,6,6-tetramethyl-4-trimethylsilyl oxy-3,5-dioxa-2,4,6-trisilaheptane PubChem CID: 79316 IUPAC Name: 4-ethenyl-2,2,6,6-tetramethyl-4-[(trimethylsilyl)oxy]-3,5-dioxa-2,4,6-trisilaheptane SMILES: C[Si](C)(C)O[Si](O[Si](C)(C)C)(O[Si](C)(C)C)C=C
| PubChem CID | 79316 |
|---|---|
| CAS | 5356-84-3 |
| Molecular Weight (g/mol) | 322.70 |
| MDL Number | MFCD00054159 |
| SMILES | C[Si](C)(C)O[Si](O[Si](C)(C)C)(O[Si](C)(C)C)C=C |
| Synonym | vinyl tris trimethylsiloxy silane,vinyltris trimethylsiloxy silane,1,1,1,5,5,5-hexamethyl-3-trimethylsilyl oxy-3-vinyltrisiloxane,tris trimethylsiloxy vinyl silane,trisiloxane, 3-ethenyl-1,1,1,5,5,5-hexamethyl-3-trimethylsilyl oxy,4-ethenyl-2,2,6,6-tetramethyl-4-trimethylsilyl oxy-3,5-dioxa-2,4,6-trisilaheptane |
| IUPAC Name | 4-ethenyl-2,2,6,6-tetramethyl-4-[(trimethylsilyl)oxy]-3,5-dioxa-2,4,6-trisilaheptane |
| InChI Key | CHEFFAKKAFRMHG-UHFFFAOYSA-N |
| Molecular Formula | C11H30O3Si4 |
Methoxydimethyl(phenyl)silane 95.0+%, TCI America™
CAS: 17881-88-8 Molecular Formula: C9H14OSi Molecular Weight (g/mol): 166.295 MDL Number: MFCD09266142 InChI Key: REQXNMOSXYEQLM-UHFFFAOYSA-N Synonym: methoxydimethylphenylsilane,methoxydimethyl phenyl silane,silane, methoxydimethylphenyl,dimethylmethoxyphenylsilane,dimethylphenylmethoxysilane,benzene, methoxydimethylsilyl,acmc-1boft,phenyldimethylmethoxysilane,amtsi001 PubChem CID: 140300 IUPAC Name: methoxy-dimethyl-phenylsilane SMILES: CO[Si](C)(C)C1=CC=CC=C1
| PubChem CID | 140300 |
|---|---|
| CAS | 17881-88-8 |
| Molecular Weight (g/mol) | 166.295 |
| MDL Number | MFCD09266142 |
| SMILES | CO[Si](C)(C)C1=CC=CC=C1 |
| Synonym | methoxydimethylphenylsilane,methoxydimethyl phenyl silane,silane, methoxydimethylphenyl,dimethylmethoxyphenylsilane,dimethylphenylmethoxysilane,benzene, methoxydimethylsilyl,acmc-1boft,phenyldimethylmethoxysilane,amtsi001 |
| IUPAC Name | methoxy-dimethyl-phenylsilane |
| InChI Key | REQXNMOSXYEQLM-UHFFFAOYSA-N |
| Molecular Formula | C9H14OSi |
Copper(II) Phthalocyanine (alpha-form) 90.0+%, TCI America™
CAS: 147-14-8 Molecular Formula: C32H16CuN8 MDL Number: MFCD00010719 Synonym: Phthalocyanine Copper(II), CuPc
| CAS | 147-14-8 |
|---|---|
| MDL Number | MFCD00010719 |
| Synonym | Phthalocyanine Copper(II), CuPc |
| Molecular Formula | C32H16CuN8 |
Chloromethyl(dichloro)methylsilane 97.0+%, TCI America™
CAS: 1558-33-4 Molecular Formula: C2H5Cl3Si Molecular Weight (g/mol): 163.497 MDL Number: MFCD00000874 InChI Key: JAYBZWYBCUJLNQ-UHFFFAOYSA-N Synonym: dichloro chloromethyl methylsilane,silane, dichloro chloromethyl methyl,ch3sicl2 ch2cl,chloromethyl methyldichlorosilane,chloromethylmethyldichlorosilane,unii-9p7n047n2s,chloromethyl dichloro methylsilane,dichloro chloromethyl methyl silane,silane cmm1,chloromethyldichloro methyl silane PubChem CID: 73788 IUPAC Name: dichloro-(chloromethyl)-methylsilane SMILES: C[Si](CCl)(Cl)Cl
| PubChem CID | 73788 |
|---|---|
| CAS | 1558-33-4 |
| Molecular Weight (g/mol) | 163.497 |
| MDL Number | MFCD00000874 |
| SMILES | C[Si](CCl)(Cl)Cl |
| Synonym | dichloro chloromethyl methylsilane,silane, dichloro chloromethyl methyl,ch3sicl2 ch2cl,chloromethyl methyldichlorosilane,chloromethylmethyldichlorosilane,unii-9p7n047n2s,chloromethyl dichloro methylsilane,dichloro chloromethyl methyl silane,silane cmm1,chloromethyldichloro methyl silane |
| IUPAC Name | dichloro-(chloromethyl)-methylsilane |
| InChI Key | JAYBZWYBCUJLNQ-UHFFFAOYSA-N |
| Molecular Formula | C2H5Cl3Si |
2-Trimethylsilylthiophene 98.0+%, TCI America™
CAS: 18245-28-8 Molecular Formula: C7H12SSi Molecular Weight (g/mol): 156.318 MDL Number: MFCD00005415 InChI Key: OANGLGSZPSFVDY-UHFFFAOYSA-N Synonym: 2-thienyltrimethylsilane,2-trimethylsilylthiophene,trimethyl thiophen-2-yl silane,silane, trimethyl-2-thienyl,trimethyl-2-thienylsilane,2-trimethylsilyl thiophene,trimethyl 2-thienyl silane,amtsi021,acmc-1c71q,thien-2-yl-trimethyl-silane PubChem CID: 140360 IUPAC Name: trimethyl(thiophen-2-yl)silane SMILES: C[Si](C)(C)C1=CC=CS1
| PubChem CID | 140360 |
|---|---|
| CAS | 18245-28-8 |
| Molecular Weight (g/mol) | 156.318 |
| MDL Number | MFCD00005415 |
| SMILES | C[Si](C)(C)C1=CC=CS1 |
| Synonym | 2-thienyltrimethylsilane,2-trimethylsilylthiophene,trimethyl thiophen-2-yl silane,silane, trimethyl-2-thienyl,trimethyl-2-thienylsilane,2-trimethylsilyl thiophene,trimethyl 2-thienyl silane,amtsi021,acmc-1c71q,thien-2-yl-trimethyl-silane |
| IUPAC Name | trimethyl(thiophen-2-yl)silane |
| InChI Key | OANGLGSZPSFVDY-UHFFFAOYSA-N |
| Molecular Formula | C7H12SSi |
Triphenylvinylsilane 93.0+%, TCI America™
CAS: 18666-68-7 Molecular Formula: C20H18Si Molecular Weight (g/mol): 286.449 MDL Number: MFCD00051542 InChI Key: OVOIHGSHJGMSMZ-UHFFFAOYSA-N Synonym: triphenylvinylsilane,silane, ethenyltriphenyl,triphenyl vinyl silane,silane, triphenylvinyl,vinyltriphenylsilane,benzene, 1,1',1-ethenylsilylidyne tris,ethenyltriphenylsilan,vinyltriphenyl silane,vinyl triphenyl silane,ethenyl triphenyl silane PubChem CID: 87747 IUPAC Name: ethenyl(triphenyl)silane SMILES: C=C[Si](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3
| PubChem CID | 87747 |
|---|---|
| CAS | 18666-68-7 |
| Molecular Weight (g/mol) | 286.449 |
| MDL Number | MFCD00051542 |
| SMILES | C=C[Si](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
| Synonym | triphenylvinylsilane,silane, ethenyltriphenyl,triphenyl vinyl silane,silane, triphenylvinyl,vinyltriphenylsilane,benzene, 1,1',1-ethenylsilylidyne tris,ethenyltriphenylsilan,vinyltriphenyl silane,vinyl triphenyl silane,ethenyl triphenyl silane |
| IUPAC Name | ethenyl(triphenyl)silane |
| InChI Key | OVOIHGSHJGMSMZ-UHFFFAOYSA-N |
| Molecular Formula | C20H18Si |
Dibutyltin Oxide 95.0+%, TCI America™
CAS: 818-08-6 Molecular Formula: C8H18OSn Molecular Weight (g/mol): 248.941 MDL Number: MFCD00001992 InChI Key: JGFBRKRYDCGYKD-UHFFFAOYSA-N Synonym: dibutyltin oxide,stannane, dibutyloxo,dibutyl oxo tin,dibutyloxostannane,di-n-butyltin oxide,tin, dibutyloxo,dibutylstannane oxide,dibutyltinoxide,dibutyltin iv oxide,dibutyloxide of tin PubChem CID: 61221 IUPAC Name: dibutyl(oxo)tin SMILES: CCCC[Sn](=O)CCCC
| PubChem CID | 61221 |
|---|---|
| CAS | 818-08-6 |
| Molecular Weight (g/mol) | 248.941 |
| MDL Number | MFCD00001992 |
| SMILES | CCCC[Sn](=O)CCCC |
| Synonym | dibutyltin oxide,stannane, dibutyloxo,dibutyl oxo tin,dibutyloxostannane,di-n-butyltin oxide,tin, dibutyloxo,dibutylstannane oxide,dibutyltinoxide,dibutyltin iv oxide,dibutyloxide of tin |
| IUPAC Name | dibutyl(oxo)tin |
| InChI Key | JGFBRKRYDCGYKD-UHFFFAOYSA-N |
| Molecular Formula | C8H18OSn |